1/* jquery.nicescroll 2-- version 3.0.0 RC7 3-- copyright 2011-12 InuYaksa*2012 4-- licensed under the MIT 5-- 6-- http://areaaperta.com/nicescroll 7-- https://github.com/inuyaksa/jquery.nicescroll 8-- 9*/ 10 11(function(jQuery){ 12 13 // globals 14 var domfocus = false; 15 var mousefocus = false; 16 var zoomactive = false; 17 var tabindexcounter = 5000; 18 var ascrailcounter = 2000; 19 20 var $ = jQuery; // sandbox 21 22 // http://stackoverflow.com/questions/2161159/get-script-path 23 function getScriptPath() { 24 var scripts=document.getElementsByTagName('script'); 25 var path=scripts[scripts.length-1].src.split('?')[0]; 26 return (path.split('/').length>0) ? path.split('/').slice(0,-1).join('/')+'/' : ''; 27 } 28 var scriptpath = getScriptPath(); 29 30 // derived by http://blog.joelambert.co.uk/2011/06/01/a-better-settimeoutsetinterval/ 31 var setAnimationFrame = (function(){ 32 return window.requestAnimationFrame || 33 window.webkitRequestAnimationFrame || 34 window.mozRequestAnimationFrame || 35 window.oRequestAnimationFrame || 36 window.msRequestAnimationFrame || 37 false; 38 })(); 39 var clearAnimationFrame = (function(){ 40 return window.cancelRequestAnimationFrame || 41 window.webkitCancelRequestAnimationFrame || 42 window.mozCancelRequestAnimationFrame || 43 window.oCancelRequestAnimationFrame || 44 window.msCancelRequestAnimationFrame || 45 false; 46 })(); 47 48 var browserdetected = false; 49 50 var getBrowserDetection = function() { 51 52 if (browserdetected) return browserdetected; 53 54 var domtest = document.createElement('DIV'); 55 56 var d = {}; 57 58 d.isopera = ("opera" in window); 59 60 d.isie = (("all" in document) && ("attachEvent" in domtest) && !d.isopera); 61 d.isieold = (d.isie && !("msInterpolationMode" in domtest.style)); // IE6 and older 62 d.isie7 = d.isie&&!d.isieold&&(!("documentMode" in document)||(document.documentMode==7)); 63 d.isie8 = d.isie&&("documentMode" in document)&&(document.documentMode==8); 64 d.isie9 = d.isie&&("performance" in window)&&(document.documentMode>=9); 65 d.isie10 = d.isie&&("performance" in window)&&(document.documentMode>=10); 66 67 d.isie9mobile = /iemobile.9/i.test(navigator.userAgent); //wp 7.1 mango 68 if (d.isie9mobile) d.isie9 = false; 69 d.isie7mobile = (!d.isie9mobile&&d.isie7) && /iemobile/i.test(navigator.userAgent); //wp 7.0 70 71 d.ismozilla = ("MozAppearance" in domtest.style); 72 d.ischrome = ("chrome" in window); 73 74 d.cantouch = ("ontouchstart" in document.documentElement); 75 d.hasmstouch = (window.navigator.msPointerEnabled||false); // IE10+ pointer events - EXPERIMENTAL 76 77 d.ismac = /^mac$/i.test(navigator.platform); 78 79 d.isios = (d.cantouch && /iphone|ipad|ipod/i.test(navigator.platform)); 80 d.isios4 = ((d.isios)&&!("seal" in Object)); 81 82 d.trstyle = false; 83 d.hastransform = false; 84 d.hastranslate3d = false; 85 d.transitionstyle = false; 86 d.hastransition = false; 87 d.transitionend = false; 88 89 var check = ['transform','msTransform','webkitTransform','MozTransform','OTransform']; 90 for(var a=0;a<check.length;a++){ 91 if (typeof domtest.style[check[a]] != "undefined") { 92 d.trstyle = check[a]; 93 break; 94 } 95 } 96 d.hastransform = (d.trstyle != false); 97 if (d.hastransform) { 98 domtest.style[d.trstyle] = "translate3d(1px,2px,3px)"; 99 d.hastranslate3d = /translate3d/.test(domtest.style[d.trstyle]); 100 } 101 102 d.transitionstyle = false; 103 d.prefixstyle = ''; 104 d.transitionend = false; 105 var check = ['transition','webkitTransition','MozTransition','OTransition','OTransition','msTransition','KhtmlTransition']; 106 var prefix = ['','-webkit-','-moz-','-o-','-o','-ms-','-khtml-']; 107 var evs = ['transitionend','webkitTransitionEnd','transitionend','otransitionend','oTransitionEnd','msTransitionEnd','KhtmlTransitionEnd']; 108 for(var a=0;a<check.length;a++) { 109 if (check[a] in domtest.style) { 110 d.transitionstyle = check[a]; 111 d.prefixstyle = prefix[a]; 112 d.transitionend = evs[a]; 113 break; 114 } 115 } 116 d.hastransition = (d.transitionstyle); 117 118 function detectCursorGrab() { 119 // thank you google for custom cursor! 120 var lst = ['-moz-grab','-webkit-grab','grab']; 121 if (d.ischrome||d.isie) lst=[]; // force setting for IE returns false positive and chrome cursor bug 122 for(var a=0;a<lst.length;a++) { 123 var p = lst[a]; 124 domtest.style['cursor']=p; 125 if (domtest.style['cursor']==p) return p; 126 } 127 return 'url(http://www.google.com/intl/en_ALL/mapfiles/openhand.cur),n-resize'; 128 } 129 d.cursorgrabvalue = detectCursorGrab(); 130 131 d.hasmousecapture = ("setCapture" in domtest); 132 133 domtest = null; //memory released 134 135 browserdetected = d; 136 137 return d; 138 } 139 140 var NiceScrollClass = function(myopt,me) { 141 142 var self = this; 143 144 this.version = '3.0.0 RC7'; 145 this.name = 'nicescroll'; 146 147 this.me = me; 148 149 this.opt = { 150 doc:$("body"), 151 win:false, 152 zindex:9000, 153 cursoropacitymin:0, 154 cursoropacitymax:1, 155 cursorcolor:"#424242", 156 cursorwidth:"5px", 157 cursorborder:"1px solid #fff",
158 cursorborderradius:"5px", 159 scrollspeed:60, 160 mousescrollstep:8*3, 161 touchbehavior:false, 162 hwacceleration:true, 163 usetransition:true, 164 boxzoom:false, 165 dblclickzoom:true, 166 gesturezoom:true, 167 grabcursorenabled:true, 168 autohidemode:true, 169 background:"", 170 iframeautoresize:true, 171 cursorminheight:20, 172 preservenativescrolling:true, 173 railoffset:false, 174 bouncescroll:true, 175 spacebarenabled:true, 176 railpadding:{top:0,right:0,left:0,bottom:0}, 177 disableoutline:true, 178 horizrailenabled:true, 179 railalign:"right", 180 railvalign:"bottom", 181 enabletranslate3d:true, 182 enablemousewheel:true, 183 enablekeyboard:true, 184 smoothscroll:true, 185 /* n33 */ 186 body:$("body"), 187 autohidemode: false, 188 cursorborder:'solid 3px transparent', 189 cursorwidth:6, 190 cursorcolor:'rgba(0,0,0,0.25)' 191 }; 192 193// Options for internal use 194 this.opt.snapbackspeed = 80; 195 196 if (myopt||false) { 197 for(var a in self.opt) { 198 if (typeof myopt[a] != "undefined") self.opt[a] = myopt[a]; 199 } 200 } 201 202 this.doc = self.opt.doc; 203 this.iddoc = (this.doc&&this.doc[0])?this.doc[0].id||'':''; 204 this.ispage = /BODY|HTML/.test((self.opt.win)?self.opt.win[0].nodeName:this.doc[0].nodeName); 205 this.haswrapper = (self.opt.win!==false); 206 this.win = self.opt.win||(this.ispage?$(window):this.doc); 207 this.docscroll = (this.ispage&&!this.haswrapper)?$(window):this.win; 208 /* n33 */ 209 this.body = self.opt.body; 210 /*******/ 211 212 this.isfixed = false; 213 214 this.iframe = false; 215 this.isiframe = ((this.doc[0].nodeName == 'IFRAME') && (this.win[0].nodeName == 'IFRAME')); 216 217 this.istextarea = (this.win[0].nodeName == 'TEXTAREA'); 218 219 this.forcescreen = false; //force to use screen position on events 220 221 this.canshowonmouseevent = (self.opt.autohidemode!="scroll"); 222 223// Events jump table 224 this.onmousedown = false; 225 this.onmouseup = false; 226 this.onmousemove = false; 227 this.onmousewheel = false; 228 this.onkeypress = false; 229 this.ongesturezoom = false; 230 this.onclick = false; 231 232// Nicescroll custom events 233 this.onscrollstart = false;
234 this.onscrollend = false; 235 this.onscrollcancel = false; 236 237 this.onzoomin = false; 238 this.onzoomout = false; 239 240// Let's start! 241 this.view = false; 242 this.page = false; 243 244 this.scroll = {x:0,y:0}; 245 this.scrollratio = {x:0,y:0}; 246 this.cursorheight = 20; 247 this.scrollvaluemax = 0; 248 249 this.scrollrunning = false; 250 251 this.scrollmom = false; 252 253 this.observer = false; 254 255 do { 256 this.id = "ascrail"+(ascrailcounter++); 257 } while (document.getElementById(this.id)); 258 259 this.rail = false; 260 this.cursor = false; 261 this.cursorfreezed = false; 262 263 this.zoom = false; 264 this.zoomactive = false; 265 266 this.hasfocus = false; 267 this.hasmousefocus = false; 268 269 this.visibility = true; 270 this.locked = false; 271 this.hidden = false; // rails always hidden 272 this.cursoractive = true; // user can interact with cursors 273 274 this.nativescrollingarea = false; 275 276 this.events = []; // event list for unbind 277 278 this.saved = {}; 279 280 this.delaylist = {}; 281 this.synclist = {}; 282 283 this.lastdeltax = 0; 284 this.lastdeltay = 0; 285 286 var cap = this.detected = getBrowserDetection(); 287 288 this.canhwscroll = (cap.hastransform&&self.opt.hwacceleration); 289 this.ishwscroll = (this.canhwscroll&&self.haswrapper); 290 291 this.istouchcapable = false; // desktop devices with touch screen support 292 293//## Check Chrome 22 bug on touch devices 294 if (cap.cantouch&&cap.ischrome&&!cap.isios) { 295 this.istouchcapable = true; 296 cap.cantouch = false; // parse normal desktop events 297 } 298 299 this.delayed = function(name,fn,tm,lazy) { 300 var dd = self.delaylist[name]; 301 var nw = (new Date()).getTime(); 302 if (!lazy&&dd&&dd.tt) return false; 303 if (dd&&dd.tt) clearTimeout(dd.tt); 304 if (dd&&dd.last+tm>nw&&!dd.tt) { 305 self.delaylist[name] = { 306 last:nw+tm, 307 tt:setTimeout(function(){self.delaylist[name].tt=0;fn.call();},tm) 308 } 309 } 310 else if (!dd||!dd.tt) { 311 self.delaylist[name] = { 312 last:nw, 313 tt:0 314 } 315 setTimeout(function(){fn.call();},0); 316 } 317 }; 318 319 this.synched = function(name,fn) { 320 321 function requestSync() { 322 if (self.onsync) return; 323 setAnimationFrame(function(){ 324 self.onsync = false; 325 for(name in self.synclist){ 326 var fn = self.synclist[name]; 327 if (fn) fn.call(self); 328 self.synclist[name] = false; 329 } 330 }); 331 self.onsync = true; 332 }; 333 334 self.synclist[name] = fn; 335 requestSync(); 336 return name; 337 }; 338 339 this.unsynched = function(name) { 340 if (self.synclist[name]) self.synclist[name] = false; 341 } 342 343 this.css = function(el,pars) { // save & set 344 for(var n in pars) { 345 self.saved.css.push([el,n,el.css(n)]); 346 el.css(n,pars[n]); 347 } 348 }; 349 350 this.scrollTop = function(val) { 351 return (typeof val == "undefined") ? self.getScrollTop() : self.setScrollTop(val); 352 }; 353 354 this.scrollLeft = function(val) { 355 return (typeof val == "undefined") ? self.getScrollLeft() : self.setScrollLeft(val); 356 }; 357 358// derived by by Dan Pupius www.pupius.net 359 BezierClass = function(st,ed,spd,p1,p2,p3,p4) { 360 this.st = st; 361 this.ed = ed; 362 this.spd = spd; 363 364 this.p1 = p1||0; 365 this.p2 = p2||1; 366 this.p3 = p3||0; 367 this.p4 = p4||1; 368 369 this.ts = (new Date()).getTime(); 370 this.df = this.ed-this.st; 371 }; 372 BezierClass.prototype = { 373 B2:function(t){ return 3*t*t*(1-t) }, 374 B3:function(t){ return 3*t*(1-t)*(1-t) }, 375 B4:function(t){ return (1-t)*(1-t)*(1-t) }, 376 getNow:function(){ 377 var nw = (new Date()).getTime(); 378 var pc = 1-((nw-this.ts)/this.spd); 379 var bz = this.B2(pc) + this.B3(pc) + this.B4(pc); 380 return (pc<0) ? this.ed : this.st+Math.round(this.df*bz); 381 }, 382 update:function(ed,spd){ 383 this.st = this.getNow(); 384 this.ed = ed; 385 this.spd = spd;
386 this.ts = (new Date()).getTime(); 387 this.df = this.ed-this.st; 388 return this; 389 } 390 }; 391 392 if (this.ishwscroll) { 393 // hw accelerated scroll 394 this.doc.translate = {x:0,y:0,tx:"0px",ty:"0px"}; 395 396 if (cap.hastranslate3d&&cap.isios) this.doc.css("-webkit-backface-visibility","hidden"); // prevent flickering http://stackoverflow.com/questions/3461441/ 397 398 //derived from http://stackoverflow.com/questions/11236090/ 399 function getMatrixValues() { 400 var tr = self.doc.css(cap.trstyle); 401 if (tr&&(tr.substr(0,6)=="matrix")) { 402 return tr.replace(/^.*\((.*)\)$/g, "$1").replace(/px/g,'').split(/, +/); 403 } 404 return false; 405 } 406 407 this.getScrollTop = function(last) { 408 if (!last) { 409 var mtx = getMatrixValues(); 410 if (mtx) return (mtx.length==16) ? -mtx[13] : -mtx[5]; //matrix3d 16 on IE10 411 if (self.timerscroll&&self.timerscroll.bz) return self.timerscroll.bz.getNow(); 412 } 413 return self.doc.translate.y; 414 }; 415
416 this.getScrollLeft = function(last) { 417 if (!last) { 418 var mtx = getMatrixValues(); 419 if (mtx) return (mtx.length==16) ? -mtx[12] : -mtx[4]; //matrix3d 16 on IE10 420 if (self.timerscroll&&self.timerscroll.bh) return self.timerscroll.bh.getNow(); 421 } 422 return self.doc.translate.x; 423 }; 424 425 if (document.createEvent) { 426 this.notifyScrollEvent = function(el) { 427 var e = document.createEvent("UIEvents"); 428 e.initUIEvent("scroll", false, true, window, 1); 429 el.dispatchEvent(e); 430 }; 431 } 432 else if (document.fireEvent) { 433 this.notifyScrollEvent = function(el) { 434 var e = document.createEventObject(); 435 el.fireEvent("onscroll"); 436 e.cancelBubble = true; 437 }; 438 } 439 else { 440 this.notifyScrollEvent = function(el,add) {}; //NOPE 441 } 442 443 if (cap.hastranslate3d&&self.opt.enabletranslate3d) { 444 this.setScrollTop = function(val,silent) { 445 self.doc.translate.y = val; 446 self.doc.translate.ty = (val*-1)+"px"; 447 self.doc.css(cap.trstyle,"translate3d("+self.doc.translate.tx+","+self.doc.translate.ty+",0px)"); 448 if (!silent) self.notifyScrollEvent(self.win[0]); 449 }; 450 this.setScrollLeft = function(val,silent) { 451 self.doc.translate.x = val; 452 self.doc.translate.tx = (val*-1)+"px"; 453 self.doc.css(cap.trstyle,"translate3d("+self.doc.translate.tx+","+self.doc.translate.ty+",0px)"); 454 if (!silent) self.notifyScrollEvent(self.win[0]); 455 }; 456 } else { 457 this.setScrollTop = function(val,silent) { 458 self.doc.translate.y = val; 459 self.doc.translate.ty = (val*-1)+"px"; 460 self.doc.css(cap.trstyle,"translate("+self.doc.translate.tx+","+self.doc.translate.ty+")"); 461 if (!silent) self.notifyScrollEvent(self.win[0]); 462 }; 463 this.setScrollLeft = function(val,silent) { 464 self.doc.translate.x = val; 465 self.doc.translate.tx = (val*-1)+"px"; 466 self.doc.css(cap.trstyle,"translate("+self.doc.translate.tx+","+self.doc.translate.ty+")"); 467 if (!silent) self.notifyScrollEvent(self.win[0]); 468 }; 469 } 470 } else { 471 // native scroll
472 this.getScrollTop = function() { 473 return self.docscroll.scrollTop(); 474 }; 475 this.setScrollTop = function(val) { 476// if (isNaN(val)) console.log("S+"+val); 477 return self.docscroll.scrollTop(val); 478 }; 479 this.getScrollLeft = function() { 480 return self.docscroll.scrollLeft(); 481 }; 482 this.setScrollLeft = function(val) { 483 return self.docscroll.scrollLeft(val); 484 }; 485 } 486 487 this.getTarget = function(e) { 488 if (!e) return false; 489 if (e.target) return e.target; 490 if (e.srcElement) return e.srcElement; 491 return false; 492 }; 493 494 this.hasParent = function(e,id) { 495 if (!e) return false; 496 var el = e.target||e.srcElement||e||false; 497 while (el && el.id != id) { 498 el = el.parentNode||false; 499 } 500 return (el!==false); 501 }; 502 503//inspired by http://forum.jquery.com/topic/width-includes-border-width-when-set-to-thin-medium-thick-in-ie 504 var _convertBorderWidth = {"thin":1,"medium":3,"thick":5}; 505 function getWidthToPixel(dom,prop,chkheight) { 506 var wd = dom.css(prop); 507 var px = parseFloat(wd); 508 if (isNaN(px)) { 509 px = _convertBorderWidth[wd]||0; 510 var brd = (px==3) ? ((chkheight)?(self.win.outerHeight() - self.win.innerHeight()):(self.win.outerWidth() - self.win.innerWidth())) : 1; //DON'T TRUST CSS 511 if (self.isie8&&px) px+=1; 512 return (brd) ? px : 0; 513 } 514 return px; 515 }; 516 517 this.updateScrollBar = function(len) { 518 if (self.ishwscroll) { 519 self.rail.css({height:self.win.innerHeight()}); 520 if (self.railh) self.railh.css({width:self.win.innerWidth()}); 521 } else { 522 var wpos = (self.isfixed) ? {top:parseFloat(self.win.css('top')),left:parseFloat(self.win.css('left'))} : self.win.offset(); 523 /* n33 */ 524 wpos.left = 0; 525 wpos.top = 0; 526 /*******/ 527 var pos = {top:wpos.top,left:wpos.left}; 528 pos.top+= getWidthToPixel(self.win,'border-top-width',true); 529 var brd = (self.win.outerWidth() - self.win.innerWidth())/2; 530 pos.left+= (self.rail.align) ? self.win.outerWidth() - getWidthToPixel(self.win,'border-right-width') - self.rail.width : getWidthToPixel(self.win,'border-left-width'); 531 532 var off = self.opt.railoffset; 533 if (off) { 534 if (off.top) pos.top+=off.top; 535 if (self.rail.align&&off.left) pos.left+=off.left; 536 } 537 538 self.rail.css({top:pos.top,left:pos.left,height:(len)?len.h:self.win.innerHeight()}); 539 if (self.zoom) self.zoom.css({top:pos.top+1,left:pos.left-20}); 540 541 if (self.railh) { 542 var pos = {top:wpos.top,left:wpos.left}; 543 var y = (self.railh.align) ? pos.top + getWidthToPixel(self.win,'border-top-width',true) + self.win.innerHeight() - self.railh.height : pos.top + getWidthToPixel(self.win,'border-top-width',true); 544 var x = pos.left + getWidthToPixel(self.win,'border-left-width'); 545 self.railh.css({top:y,left:x,width:self.railh.width}); 546 } 547 } 548 }; 549 550 self.hasanimationframe = (setAnimationFrame); 551 self.hascancelanimationframe = (clearAnimationFrame); 552 553 if (!self.hasanimationframe) { 554 setAnimationFrame=function(fn){return setTimeout(fn,16)}; // 1000/60)}; 555 clearAnimationFrame=clearInterval; 556 } 557 else if (!self.hascancelanimationframe) clearAnimationFrame=function(){self.cancelAnimationFrame=true}; 558 559 this.init = function() { 560 561 self.saved.css = []; 562 563 if (cap.isie7mobile) return true; // SORRY, DO NOT WORK! 564 565 if (cap.hasmstouch) self.css((self.ispage)?$("html"):self.win,{'-ms-touch-action':'none'}); 566 567/* 568 self.ispage = true; 569 self.haswrapper = true; 570// self.win = $(window); 571 self.docscroll = $("body"); 572// self.doc = $("body"); 573*/ 574 575 if (!self.ispage || (!cap.cantouch && !cap.isieold && !cap.isie9mobile)) { 576 577 var cont = self.docscroll; 578 if (self.ispage) cont = (self.haswrapper)?self.win:self.doc; 579 580 if (!cap.isie9mobile) self.css(cont,{'overflow-y':'hidden'}); 581 582 if (self.ispage&&cap.isie7) { 583 if (self.doc[0].nodeName=='BODY') self.css($("html"),{'overflow-y':'hidden'}); //IE7 double scrollbar issue 584 else if (self.doc[0].nodeName=='HTML') self.css($("body"),{'overflow-y':'hidden'}); //IE7 double scrollbar issue 585 } 586 587 if (cap.isios&&!self.ispage&&!self.haswrapper) self.css($("body"),{"-webkit-overflow-scrolling":"touch"}); //force hw acceleration 588 589 var cursor = $(document.createElement('div')); 590 /** n33 **/ 591 cursor.attr('class', 'nicescroll-cursor'); 592 /*********/ 593 cursor.css({ 594 position:"relative",top:0,"float":"right",width:self.opt.cursorwidth,height:"0px", 595 'background-color':self.opt.cursorcolor, 596 border:self.opt.cursorborder, 597 'background-clip':'padding-box',
598 '-webkit-border-radius':self.opt.cursorborderradius, 599 '-moz-border-radius':self.opt.cursorborderradius, 600 'border-radius':self.opt.cursorborderradius 601 }); 602 603 cursor.hborder = parseFloat(cursor.outerHeight() - cursor.innerHeight()); 604 self.cursor = cursor; 605 606 var rail = $(document.createElement('div')); 607 rail.attr('id',self.id); 608 609 var v,a,kp = ["left","right"]; //"top","bottom" 610 for(var n in kp) { 611 a=kp[n]; 612 v = self.opt.railpadding[a]; 613 (v) ? rail.css("padding-"+a,v+"px") : self.opt.railpadding[a] = 0; 614 } 615 616 rail.append(cursor); 617 618 rail.width = Math.max(parseFloat(self.opt.cursorwidth),cursor.outerWidth()) + self.opt.railpadding['left'] + self.opt.railpadding['right']; 619 rail.css({width:rail.width+"px",'zIndex':(self.ispage)?self.opt.zindex:self.opt.zindex+2,"background":self.opt.background}); 620 621 rail.visibility = true; 622 rail.scrollable = true; 623 624 rail.align = (self.opt.railalign=="left") ? 0 : 1; 625 626 self.rail = rail; 627 628 self.rail.drag = false; 629 630 var zoom = false; 631 if (self.opt.boxzoom&&!self.ispage&&!cap.isieold) { 632 zoom = document.createElement('div'); 633 self.bind(zoom,"click",self.doZoom); 634 self.zoom = $(zoom); 635 self.zoom.css({"cursor":"pointer",'z-index':self.opt.zindex,'backgroundImage':'url('+scriptpath+'zoomico.png)','height':18,'width':18,'backgroundPosition':'0px 0px'}); 636 if (self.opt.dblclickzoom) self.bind(self.win,"dblclick",self.doZoom); 637 if (cap.cantouch&&self.opt.gesturezoom) { 638 self.ongesturezoom = function(e) { 639 if (e.scale>1.5) self.doZoomIn(e); 640 if (e.scale<0.8) self.doZoomOut(e); 641 return self.cancelEvent(e); 642 }; 643 self.bind(self.win,"gestureend",self.ongesturezoom); 644 } 645 } 646 647// init HORIZ 648 649 self.railh = false; 650 651 if (self.opt.horizrailenabled) { 652 653 self.css(cont,{'overflow-x':'hidden'}); 654 655 var cursor = $(document.createElement('div')); 656 cursor.css({ 657 position:"relative",top:0,height:self.opt.cursorwidth,width:"0px", 658 'background-color':self.opt.cursorcolor, 659 border:self.opt.cursorborder, 660 'background-clip':'padding-box', 661 '-webkit-border-radius':self.opt.cursorborderradius, 662 '-moz-border-radius':self.opt.cursorborderradius, 663 'border-radius':self.opt.cursorborderradius 664 }); 665 666 cursor.wborder = parseFloat(cursor.outerWidth() - cursor.innerWidth()); 667 self.cursorh = cursor; 668 669 var railh = $(document.createElement('div')); 670 railh.attr('id',self.id+'-hr'); 671 railh.height = 1+Math.max(parseFloat(self.opt.cursorwidth),cursor.outerHeight()); 672 railh.css({height:railh.height+"px",'zIndex':(self.ispage)?self.opt.zindex:self.opt.zindex+2,"background":self.opt.background}); 673 674 railh.append(cursor); 675 676 railh.visibility = true; 677 railh.scrollable = true; 678 679 railh.align = (self.opt.railvalign=="top") ? 0 : 1; 680 681 self.railh = railh; 682 683 self.railh.drag = false; 684 685 } 686 687// 688 689 if (self.ispage) { 690 rail.css({position:"fixed",top:"0px",height:"100%"}); 691 (rail.align) ? rail.css({right:"0px"}) : rail.css({left:"0px"}); 692 self.body.append(rail); 693 if (self.railh) { 694 railh.css({position:"fixed",left:"0px",width:"100%"}); 695 (railh.align) ? railh.css({bottom:"0px"}) : railh.css({top:"0px"}); 696 self.body.append(railh); 697 } 698 } else { 699 if (self.ishwscroll) { 700 if (self.win.css('position')=='static') self.css(self.win,{'position':'relative'}); 701 var bd = (self.win[0].nodeName == 'HTML') ? self.body : self.win; 702 if (self.zoom) { 703 self.zoom.css({position:"absolute",top:1,right:0,"margin-right":rail.width+4}); 704 bd.append(self.zoom); 705 } 706 rail.css({position:"absolute",top:0}); 707 (rail.align) ? rail.css({right:0}) : rail.css({left:0}); 708 bd.append(rail); 709 if (railh) { 710 railh.css({position:"absolute",left:0,bottom:0}); 711 (railh.align) ? railh.css({bottom:0}) : railh.css({top:0}); 712 bd.append(railh); 713 } 714 } else { 715 self.isfixed = (self.win.css("position")=="fixed"); 716 var rlpos = (self.isfixed) ? "fixed" : "absolute"; 717 718 rail.css({position:rlpos}); 719 if (self.zoom) self.zoom.css({position:rlpos}); 720 self.updateScrollBar(); 721 self.body.append(rail); 722 if (self.zoom) self.body.append(self.zoom); 723 if (self.railh) { 724 railh.css({position:rlpos}); 725 self.body.append(railh); 726 } 727 } 728 729 if (cap.isios) self.css(self.win,{'-webkit-tap-highlight-color':'rgba(0,0,0,0)','-webkit-touch-callout':'none'}); // prevent grey layer on click 730 if (cap.isie&&self.opt.disableoutline) self.win.attr("hideFocus","true"); // IE, prevent dotted rectangle on focused div 731 732 } 733 734 if (self.opt.autohidemode===false) { 735 self.autohidedom = false;
736 } 737 else if (self.opt.autohidemode===true) { 738 self.autohidedom = $().add(self.rail); 739 if (self.railh) self.autohidedom=self.autohidedom.add(self.railh); 740 } 741 else if (self.opt.autohidemode=="scroll") { 742 self.autohidedom = $().add(self.rail); 743 if (self.railh) self.autohidedom=self.autohidedom.add(self.railh); 744 } 745 else if (self.opt.autohidemode=="cursor") { 746 self.autohidedom = $().add(self.cursor); 747 if (self.railh) self.autohidedom=self.autohidedom.add(self.railh.cursor); 748 } 749 else if (self.opt.autohidemode=="hidden") { 750 self.autohidedom = false; 751 self.hide(); 752 self.locked = false; 753 } 754 755 if (cap.isie9mobile) { 756 757 self.scrollmom = new ScrollMomentumClass2D(self); 758 759 /* 760 var trace = function(msg) { 761 var db = $("#debug"); 762 if (isNaN(msg)&&(typeof msg != "string")) { 763 var x = []; 764 for(var a in msg) { 765 x.push(a+":"+msg[a]); 766 } 767 msg ="{"+x.join(",")+"}"; 768 } 769 if (db.children().length>0) { 770 db.children().eq(0).before("<div>"+msg+"</div>"); 771 } else { 772 db.append("<div>"+msg+"</div>"); 773 } 774 } 775 window.onerror = function(msg,url,ln) { 776 trace("ERR: "+msg+" at "+ln); 777 } 778*/ 779 780 self.onmangotouch = function(e) { 781 var py = self.getScrollTop(); 782 var px = self.getScrollLeft(); 783 784 if ((py == self.scrollmom.lastscrolly)&&(px == self.scrollmom.lastscrollx)) return true; 785// $("#debug").html('DRAG:'+py); 786 787 var dfy = py-self.mangotouch.sy; 788 var dfx = px-self.mangotouch.sx; 789 var df = Math.round(Math.sqrt(Math.pow(dfx,2)+Math.pow(dfy,2))); 790 if (df==0) return; 791 792 var dry = (dfy<0)?-1:1; 793 var drx = (dfx<0)?-1:1; 794 795 var tm = +new Date(); 796 if (self.mangotouch.lazy) clearTimeout(self.mangotouch.lazy); 797 798 if (((tm-self.mangotouch.tm)>80)||(self.mangotouch.dry!=dry)||(self.mangotouch.drx!=drx)) { 799// trace('RESET+'+(tm-self.mangotouch.tm)); 800 self.scrollmom.stop(); 801 self.scrollmom.reset(px,py); 802 self.mangotouch.sy = py; 803 self.mangotouch.ly = py; 804 self.mangotouch.sx = px; 805 self.mangotouch.lx = px; 806 self.mangotouch.dry = dry; 807 self.mangotouch.drx = drx; 808 self.mangotouch.tm = tm; 809 } else { 810 811 self.scrollmom.stop(); 812 self.scrollmom.update(self.mangotouch.sx-dfx,self.mangotouch.sy-dfy); 813 var gap = tm - self.mangotouch.tm; 814 self.mangotouch.tm = tm; 815 816// trace('MOVE:'+df+" - "+gap); 817 818 var ds = Math.max(Math.abs(self.mangotouch.ly-py),Math.abs(self.mangotouch.lx-px)); 819 self.mangotouch.ly = py; 820 self.mangotouch.lx = px; 821 822 if (ds>2) { 823 self.mangotouch.lazy = setTimeout(function(){ 824// trace('END:'+ds+'+'+gap); 825 self.mangotouch.lazy = false; 826 self.mangotouch.dry = 0; 827 self.mangotouch.drx = 0; 828 self.mangotouch.tm = 0; 829 self.scrollmom.doMomentum(30); 830 },100); 831 } 832 } 833 } 834 835 var top = self.getScrollTop(); 836 var lef = self.getScrollLeft(); 837 self.mangotouch = {sy:top,ly:top,dry:0,sx:lef,lx:lef,drx:0,lazy:false,tm:0}; 838 839 self.bind(self.docscroll,"scroll",self.onmangotouch); 840 841 } else { 842 843 if (cap.cantouch||self.opt.touchbehavior||cap.hasmstouch) { 844 845 self.scrollmom = new ScrollMomentumClass2D(self); 846 847 self.ontouchstart = function(e) { 848 if (e.pointerType&&e.pointerType!=2) return false;
849 850 if (!self.locked) { 851 852 if (cap.hasmstouch) { 853 var tg = (e.target) ? e.target : false; 854 while (tg) { 855 var nc = $(tg).getNiceScroll(); 856 if ((nc.length>0)&&(nc[0].me == self.me)) break; 857 if (nc.length>0) return false; 858 if ((tg.nodeName=='DIV')&&(tg.id==self.id)) break; 859 tg = (tg.parentNode) ? tg.parentNode : false; 860 } 861 } 862 863 self.cancelScroll(); 864 865 var tg = self.getTarget(e); 866 867 if (tg) { 868 var skp = (/INPUT/i.test(tg.nodeName))&&(/range/i.test(tg.type)); 869 if (skp) return self.stopPropagation(e); 870 } 871 872 if (self.forcescreen) { 873 var le = e; 874 var e = {"original":(e.original)?e.original:e}; 875 e.clientX = le.screenX; 876 e.clientY = le.screenY; 877 //console.log(e); 878 } 879 880 self.rail.drag = {x:e.clientX,y:e.clientY,sx:self.scroll.x,sy:self.scroll.y,st:self.getScrollTop(),sl:self.getScrollLeft(),pt:2}; 881 882 if (self.opt.touchbehavior&&self.isiframe&&cap.isie) { 883 var wp = self.win.position(); 884 self.rail.drag.x+=wp.left; 885 self.rail.drag.y+=wp.top; 886 } 887 888 self.hasmoving = false; 889 self.lastmouseup = false; 890 self.scrollmom.reset(e.clientX,e.clientY); 891 if (!cap.cantouch&&!this.istouchcapable&&!cap.hasmstouch) { 892 893 var ip = (tg)?/INPUT|SELECT|TEXTAREA/i.test(tg.nodeName):false; 894 if (!ip) { 895 if (!self.ispage&&cap.hasmousecapture) tg.setCapture(); 896 return self.cancelEvent(e); 897 } 898 if (/SUBMIT|CANCEL|BUTTON/i.test($(tg).attr('type'))) { 899 pc = {"tg":tg,"click":false}; 900 self.preventclick = pc; 901 } 902 } 903 } 904 905 }; 906 907 self.ontouchend = function(e) { 908 if (e.pointerType&&e.pointerType!=2) return false; 909 if (self.rail.drag&&(self.rail.drag.pt==2)) { 910 self.scrollmom.doMomentum(); 911 self.rail.drag = false; 912 if (self.hasmoving) { 913 self.hasmoving = false; 914 self.lastmouseup = true; 915 self.hideCursor(); 916 if (cap.hasmousecapture) document.releaseCapture(); 917 if (!cap.cantouch) return self.cancelEvent(e); 918 } 919 } 920 921 }; 922 923 var moveneedoffset = (self.opt.touchbehavior&&self.isiframe&&!cap.hasmousecapture); 924 925 self.ontouchmove = function(e,byiframe) { 926 927 if (e.pointerType&&e.pointerType!=2) return false; 928 929 if (self.rail.drag&&(self.rail.drag.pt==2)) { 930 if (cap.cantouch&&(typeof e.original == "undefined")) return true; // prevent ios "ghost" events by clickable elements 931 932 self.hasmoving = true; 933 934 if (self.preventclick&&!self.preventclick.click) { 935 self.preventclick.click = self.preventclick.tg.onclick||false; 936 self.preventclick.tg.onclick = self.onpreventclick; 937 } 938 939 if (self.forcescreen) { 940 var le = e; 941 var e = {"original":(e.original)?e.original:e}; 942 e.clientX = le.screenX; 943 e.clientY = le.screenY; 944 //console.log(e); 945 } 946 947 var ofx = ofy = 0; 948 949 if (moveneedoffset&&!byiframe) { 950 var wp = self.win.position(); 951 ofx=-wp.left; 952 ofy=-wp.top; 953 } 954 955 var fy = e.clientY + ofy; 956 var my = (fy-self.rail.drag.y); 957 958 var ny = self.rail.drag.st-my; 959 960 if (self.ishwscroll&&self.opt.bouncescroll) { 961 if (ny<0) { 962 ny = Math.round(ny/2); 963// fy = 0; 964 } 965 else if (ny>self.page.maxh) { 966 ny = self.page.maxh+Math.round((ny-self.page.maxh)/2); 967// fy = 0; 968 } 969 } else { 970 if (ny<0) {ny=0;fy=0} 971 if (ny>self.page.maxh) {ny=self.page.maxh;fy=0} 972 } 973 974 var fx = e.clientX + ofx; 975 976 if (self.railh&&self.railh.scrollable) { 977 978 var mx = (fx-self.rail.drag.x); 979 980 var nx = self.rail.drag.sl-mx; 981 982 if (self.ishwscroll&&self.opt.bouncescroll) { 983 if (nx<0) { 984 nx = Math.round(nx/2); 985// fx = 0; 986 } 987 else if (nx>self.page.maxw) { 988 nx = self.page.maxw+Math.round((nx-self.page.maxw)/2); 989// fx = 0; 990 } 991 } else { 992 if (nx<0) {nx=0;fx=0} 993 if (nx>self.page.maxw) {nx=self.page.maxw;fx=0} 994 } 995 996 } 997 998 self.synched("touchmove",function(){ 999 if (self.rail.drag&&(self.rail.drag.pt==2)) { 1000 if (self.prepareTransition) self.prepareTransition(0); 1001 if (self.rail.scrollable) self.setScrollTop(ny); 1002 self.scrollmom.update(fx,fy); 1003 if (self.railh&&self.railh.scrollable) { 1004 self.setScrollLeft(nx); 1005 self.showCursor(ny,nx); 1006 } else { 1007 self.showCursor(ny); 1008 } 1009 if (cap.isie10) document.selection.clear(); 1010 } 1011 }); 1012 1013 return self.cancelEvent(e); 1014 } 1015 1016 }; 1017 1018 } 1019 1020 if (cap.cantouch||self.opt.touchbehavior) { 1021 1022 self.onpreventclick = function(e) { 1023 if (self.preventclick) {
1024 self.preventclick.tg.onclick = self.preventclick.click; 1025 self.preventclick = false; 1026 return self.cancelEvent(e); 1027 } 1028 } 1029 1030 self.onmousedown = self.ontouchstart; 1031 1032 self.onmouseup = self.ontouchend; 1033 1034 self.onclick = (cap.isios) ? false : function(e) { 1035 if (self.lastmouseup) { 1036 self.lastmouseup = false; 1037 return self.cancelEvent(e); 1038 } else { 1039 return true; 1040 } 1041 }; 1042 1043 self.onmousemove = self.ontouchmove; 1044 1045 if (cap.cursorgrabvalue) { 1046 self.css((self.ispage)?self.doc:self.win,{'cursor':cap.cursorgrabvalue}); 1047 self.css(self.rail,{'cursor':cap.cursorgrabvalue}); 1048 } 1049 1050 } else { 1051 1052 self.onmousedown = function(e,hronly) { 1053 if (self.rail.drag&&self.rail.drag.pt!=1) return; 1054 if (self.locked) return self.cancelEvent(e); 1055 self.cancelScroll(); 1056 self.rail.drag = {x:e.clientX,y:e.clientY,sx:self.scroll.x,sy:self.scroll.y,pt:1,hr:(!!hronly)}; 1057 var tg = self.getTarget(e); 1058 if (!self.ispage&&cap.hasmousecapture) tg.setCapture(); 1059 return self.cancelEvent(e); 1060 }; 1061 self.onmouseup = function(e) { 1062 if (self.rail.drag) { 1063 if (cap.hasmousecapture) document.releaseCapture(); 1064 if(self.rail.drag.pt!=1)return; 1065 self.rail.drag = false; 1066 return self.cancelEvent(e); 1067 } 1068 }; 1069 self.onmousemove = function(e) { 1070 1071 if (self.rail.drag) { 1072 if(self.rail.drag.pt!=1)return; 1073 1074 self.cursorfreezed = true; 1075 1076 if (self.rail.drag.hr) { 1077 self.scroll.x = self.rail.drag.sx + (e.clientX-self.rail.drag.x); 1078 if (self.scroll.x<0) self.scroll.x=0; 1079 var mw = self.scrollvaluemaxw; 1080 if (self.scroll.x>mw) self.scroll.x=mw; 1081 } else { 1082 self.scroll.y = self.rail.drag.sy + (e.clientY-self.rail.drag.y); 1083 if (self.scroll.y<0) self.scroll.y=0; 1084 var my = self.scrollvaluemax; 1085 if (self.scroll.y>my) self.scroll.y=my; 1086 } 1087 1088 self.synched('mousemove',function(){ 1089 if (self.rail.drag&&(self.rail.drag.pt==1)) { 1090 self.showCursor(); 1091 if (self.rail.drag.hr) self.doScrollLeft(Math.round(self.scroll.x*self.scrollratio.x)); 1092 else self.doScrollTop(Math.round(self.scroll.y*self.scrollratio.y)); 1093 } 1094 }); 1095 return self.cancelEvent(e); 1096 } else { 1097 self.checkarea = true; 1098 } 1099 }; 1100 } 1101 1102 if (cap.cantouch||self.opt.touchbehavior) { 1103 self.bind(self.win,"mousedown",self.onmousedown); 1104 } 1105 1106 if (cap.hasmstouch) { 1107 self.css(self.rail,{'-ms-touch-action':'none'}); 1108 self.css(self.cursor,{'-ms-touch-action':'none'}); 1109 1110 self.bind(self.win,"MSPointerDown",self.ontouchstart); 1111 self.bind(document,"MSPointerUp",self.ontouchend); 1112 self.bind(document,"MSPointerMove",self.ontouchmove); 1113 self.bind(self.cursor,"MSGestureHold",function(e){e.preventDefault();}); 1114 self.bind(self.cursor,"contextmenu",function(e){e.preventDefault();}); 1115 } 1116 1117 if (this.istouchcapable) { //device with screen touch enabled 1118 self.bind(self.win,"touchstart",self.ontouchstart); 1119 self.bind(document,"touchend",self.ontouchend); 1120 self.bind(document,"touchmove",self.ontouchmove); 1121 } 1122 1123 self.bind(self.cursor,"mousedown",self.onmousedown); 1124 self.bind(self.cursor,"mouseup",self.onmouseup); 1125 1126 if (self.railh) { 1127 self.bind(self.cursorh,"mousedown",function(e){self.onmousedown(e,true)}); 1128 self.bind(self.cursorh,"mouseup",function(e){ 1129 if (self.rail.drag&&self.rail.drag.pt==2) return; 1130 self.rail.drag = false;
1131 self.hasmoving = false; 1132 self.hideCursor(); 1133 if (cap.hasmousecapture) document.releaseCapture(); 1134 return self.cancelEvent(e); 1135 }); 1136 } 1137 1138 self.bind(document,"mouseup",self.onmouseup); 1139 if (cap.hasmousecapture) self.bind(self.win,"mouseup",self.onmouseup); 1140 1141 self.bind(document,"mousemove",self.onmousemove); 1142 if (self.onclick) self.bind(document,"click",self.onclick); 1143 1144 if (!cap.cantouch) { 1145 self.rail.mouseenter(function() { 1146 if (self.canshowonmouseevent) self.showCursor(); 1147 self.rail.active = true; 1148 }); 1149 self.rail.mouseleave(function() { 1150 self.rail.active = false; 1151 if (!self.rail.drag) self.hideCursor(); 1152 }); 1153 1154 if (self.railh) { 1155 self.railh.mouseenter(function() { 1156 if (self.canshowonmouseevent) self.showCursor(); 1157 self.rail.active = true; 1158 }); 1159 self.railh.mouseleave(function() { 1160 self.rail.active = false; 1161 if (!self.rail.drag) self.hideCursor(); 1162 }); 1163 } 1164 1165 if (self.opt.enablemousewheel) { 1166 if (!self.isiframe) self.bind((cap.isie&&self.ispage) ? document : self.docscroll,"mousewheel",self.onmousewheel); 1167 self.bind(self.rail,"mousewheel",self.onmousewheel); 1168 if (self.railh) self.bind(self.railh,"mousewheel",self.onmousewheelhr); 1169 } 1170 } 1171 1172 if (self.zoom) { 1173 self.zoom.mouseenter(function() { 1174 if (self.canshowonmouseevent) self.showCursor(); 1175 self.rail.active = true; 1176 }); 1177 self.zoom.mouseleave(function() { 1178 self.rail.active = false; 1179 if (!self.rail.drag) self.hideCursor(); 1180 }); 1181 } 1182 1183 if (!self.ispage&&!cap.cantouch&&!(/HTML|BODY/.test(self.win[0].nodeName))) { 1184 if (!self.win.attr("tabindex")) self.win.attr({"tabindex":tabindexcounter++}); 1185 1186 if (cap.ischrome&&self.opt.disableoutline) self.win.css({"outline":"none"}); 1187 1188 self.win.focus(function(e) { 1189 domfocus = (self.getTarget(e)).id||true; 1190 self.hasfocus = true; 1191 if (self.canshowonmouseevent) self.noticeCursor(); 1192 }); 1193 self.win.blur(function(e) { 1194 domfocus = false; 1195 self.hasfocus = false; 1196 }); 1197 1198 self.win.mouseenter(function(e) { 1199 mousefocus = (self.getTarget(e)).id||true; 1200 self.hasmousefocus = true; 1201 if (self.canshowonmouseevent) self.noticeCursor(); 1202 }); 1203 self.win.mouseleave(function() { 1204 mousefocus = false; 1205 self.hasmousefocus = false; 1206 }); 1207 1208 }; 1209 1210 } // !ie9mobile 1211 1212 //Thanks to http://www.quirksmode.org !! 1213 self.onkeypress = function(e) { 1214 if (self.locked&&self.page.maxh==0) return true; 1215 e = (e) ? e : window.e; 1216 var tg = self.getTarget(e); 1217 if (tg&&/INPUT|TEXTAREA|SELECT|OPTION/.test(tg.nodeName)) { 1218 var tp = tg.getAttribute('type')||tg.type||false; 1219 if ((!tp)||!(/submit|button|cancel/i.tp)) return true; 1220 } 1221 1222 if (self.hasfocus||(self.hasmousefocus&&!domfocus)||(self.ispage&&!domfocus&&!mousefocus)) { 1223 var key = e.keyCode; 1224 var ctrl = e.ctrlKey||false; 1225 1226 if (self.locked&&key!=27) return self.cancelEvent(e); 1227 1228 var ret = false;
1229 switch (key) { 1230 case 38: 1231 case 63233: //safari 1232 self.doScrollBy(24*3); 1233 ret = true; 1234 break; 1235 case 40: 1236 case 63235: //safari 1237 self.doScrollBy(-24*3); 1238 ret = true; 1239 break; 1240 case 37: 1241 case 63232: //safari 1242 if (self.railh) { 1243 (ctrl) ? self.doScrollLeft(0) : self.doScrollLeftBy(24*3); 1244 ret = true; 1245 } 1246 break; 1247 case 39: 1248 case 63234: //safari 1249 if (self.railh) { 1250 (ctrl) ? self.doScrollLeft(self.page.maxw) : self.doScrollLeftBy(-24*3); 1251 ret = true; 1252 } 1253 break; 1254 case 33: 1255 case 63276: // safari 1256 self.doScrollBy(self.view.h); 1257 ret = true; 1258 break; 1259 case 34: 1260 case 63277: // safari 1261 self.doScrollBy(-self.view.h); 1262 ret = true; 1263 break; 1264 case 36: 1265 case 63273: // safari 1266 (self.railh&&ctrl) ? self.doScrollPos(0,0) : self.doScrollTo(0); 1267 ret = true; 1268 break; 1269 case 35: 1270 case 63275: // safari 1271 (self.railh&&ctrl) ? self.doScrollPos(self.page.maxw,self.page.maxh) : self.doScrollTo(self.page.maxh); 1272 ret = true; 1273 break; 1274 case 32: 1275 if (self.opt.spacebarenabled) { 1276 self.doScrollBy(-self.view.h); 1277 ret = true; 1278 } 1279 break; 1280 case 27: // ESC 1281 if (self.zoomactive) { 1282 self.doZoom(); 1283 ret = true; 1284 } 1285 break; 1286 } 1287 if (ret) return self.cancelEvent(e); 1288 } 1289 }; 1290 1291 if (self.opt.enablekeyboard) self.bind(document,(cap.isopera)?"keypress":"keydown",self.onkeypress); 1292 1293 self.bind(window,'resize',self.resize); 1294 self.bind(window,'orientationchange',self.resize); 1295 1296 self.bind(window,"load",self.resize); 1297 1298 if (cap.ischrome&&!self.ispage&&!self.haswrapper) { //chrome void scrollbar bug 1299 var ww=self.win.width(); 1300 self.win.css('width',ww-0.1); 1301 self.synched("chromefix",function(){self.win.css('width',ww)}); 1302 } 1303 1304// Trying a cross-browser implementation - good luck! 1305 1306 self.onAttributeChange = function(e) { 1307 self.lazyResize(); 1308 } 1309 1310 if (!self.ispage&&!self.haswrapper) { 1311 // thanks to Filip http://stackoverflow.com/questions/1882224/ 1312 if ("WebKitMutationObserver" in window) { 1313 self.observer = new WebKitMutationObserver(function(mutations) { 1314 mutations.forEach(self.onAttributeChange); 1315 }); 1316 self.observer.observe(self.win[0],{attributes:true,subtree:false}); 1317 } else { 1318 self.bind(self.win,(cap.isie&&!cap.isie9)?"propertychange":"DOMAttrModified",self.onAttributeChange); 1319 if (cap.isie9) self.win[0].attachEvent("onpropertychange",self.onAttributeChange); //IE9 DOMAttrModified bug 1320 } 1321 } 1322 1323// 1324 1325 if (!self.ispage&&self.opt.boxzoom) self.bind(window,"resize",self.resizeZoom); 1326 if (self.istextarea) self.bind(self.win,"mouseup",self.resize); 1327 1328 self.resize(); 1329 1330 } 1331 1332 if (this.doc[0].nodeName == 'IFRAME') { 1333 function oniframeload(e) { 1334 self.iframexd = false; 1335 try { 1336 var doc = 'contentDocument' in this ? this.contentDocument : this.contentWindow.document; 1337 var a = doc.domain; 1338 } catch(e){self.iframexd = true;doc=false}; 1339 1340 if (self.iframexd) { 1341 if ("console" in window) console.log('NiceScroll error: policy restriced iframe'); 1342 return true; //cross-domain - I can't manage this 1343 } 1344 1345 self.forcescreen = true; 1346 1347 if (self.isiframe) { 1348 self.iframe = { 1349 html:self.doc.contents().find('html')[0], 1350 body:self.doc.contents().find('body')[0] 1351 }; 1352 self.getContentSize = function(){ 1353 return { 1354 w:Math.max(self.iframe.html.scrollWidth,self.iframe.body.scrollWidth), 1355 h:Math.max(self.iframe.html.scrollHeight,self.iframe.body.scrollHeight) 1356 } 1357 } 1358 self.docscroll = $(this.contentWindow); 1359 } 1360 1361 if (!cap.isios&&self.opt.iframeautoresize&&!self.isiframe) { 1362 self.win.scrollTop(0); // reset position 1363 self.doc.height(""); //reset height to fix browser bug 1364 var hh=Math.max(doc.getElementsByTagName('html')[0].scrollHeight,doc.body.scrollHeight); 1365 self.doc.height(hh); 1366 } 1367 self.resize(); 1368 1369 if (cap.isie7) self.css($(doc).find('html'),{'overflow-y':'hidden'}); 1370 self.css($(doc.body),{'overflow-y':'hidden'});
1371 if ('contentWindow' in this) { 1372 self.bind(this.contentWindow,"scroll",self.onscroll); //IE8 & minor 1373 } else { 1374 self.bind(doc,"scroll",self.onscroll); 1375 } 1376 1377 if (self.opt.enablemousewheel) { 1378 self.bind(doc,"mousewheel",self.onmousewheel); 1379 } 1380 1381 if (self.opt.enablekeyboard) self.bind(doc,(cap.isopera)?"keypress":"keydown",self.onkeypress); 1382 1383 if (cap.cantouch||self.opt.touchbehavior) { 1384 self.bind(doc,"mousedown",self.onmousedown); 1385 if (cap.cursorgrabvalue) self.css($(doc.body),{'cursor':cap.cursorgrabvalue}); 1386 } 1387 1388 self.bind(doc,"mouseup",self.onmouseup); 1389 self.bind(doc,"mousemove",function(e){self.onmousemove(e,true)}); 1390 1391 if (self.zoom) { 1392 if (self.opt.dblclickzoom) self.bind(doc,'dblclick',self.doZoom); 1393 if (self.ongesturezoom) self.bind(doc,"gestureend",self.ongesturezoom); 1394 } 1395 }; 1396 1397 if (this.doc[0].readyState&&this.doc[0].readyState=="complete"){ 1398 setTimeout(function(){oniframeload.call(self.doc[0],false)},500); 1399 } 1400 self.bind(this.doc,"load",oniframeload); 1401 1402 } 1403 1404 }; 1405 1406 this.showCursor = function(py,px) { 1407 if (self.cursortimeout) { 1408 clearTimeout(self.cursortimeout); 1409 self.cursortimeout = 0; 1410 } 1411 if (!self.rail) return; 1412 if (self.autohidedom) { 1413 self.autohidedom.stop().css({opacity:self.opt.cursoropacitymax}); 1414 self.cursoractive = true; 1415 } 1416 1417 if ((typeof py != "undefined")&&(py!==false)) { 1418 self.scroll.y = Math.round(py * 1/self.scrollratio.y); 1419 } 1420 if (typeof px != "undefined") { 1421 self.scroll.x = Math.round(px * 1/self.scrollratio.x); 1422 } 1423 1424 self.cursor.css({height:self.cursorheight,top:self.scroll.y}); 1425 if (self.cursorh) { 1426 (!self.rail.align&&self.rail.visibility) ? self.cursorh.css({width:self.cursorwidth,left:self.scroll.x+self.rail.width}) : self.cursorh.css({width:self.cursorwidth,left:self.scroll.x}); 1427 self.cursoractive = true; 1428 } 1429 1430 if (self.zoom) self.zoom.stop().css({opacity:self.opt.cursoropacitymax}); 1431 }; 1432 1433 this.hideCursor = function(tm) { 1434 if (self.cursortimeout) return; 1435 if (!self.rail) return; 1436 if (!self.autohidedom) return; 1437 self.cursortimeout = setTimeout(function() { 1438 if (!self.rail.active||!self.showonmouseevent) { 1439 self.autohidedom.stop().animate({opacity:self.opt.cursoropacitymin}); 1440 if (self.zoom) self.zoom.stop().animate({opacity:self.opt.cursoropacitymin}); 1441 self.cursoractive = false; 1442 } 1443 self.cursortimeout = 0; 1444 },tm||400); 1445 }; 1446 1447 this.noticeCursor = function(tm,py,px) { 1448 self.showCursor(py,px); 1449 self.hideCursor(tm); 1450 }; 1451 1452 this.getContentSize = 1453 (self.ispage) ? 1454 function(){ 1455 return { 1456 w:Math.max(document.body.scrollWidth,document.documentElement.scrollWidth), 1457 h:Math.max(document.body.scrollHeight,document.documentElement.scrollHeight) 1458 } 1459 } 1460 : (self.haswrapper) ? 1461 function(){ 1462 return { 1463 w:self.doc.outerWidth()+parseInt(self.win.css('paddingLeft'))+parseInt(self.win.css('paddingRight')), 1464 h:self.doc.outerHeight()+parseInt(self.win.css('paddingTop'))+parseInt(self.win.css('paddingBottom')) 1465 } 1466 } 1467 : function() { 1468 return { 1469 w:self.docscroll[0].scrollWidth, 1470 h:self.docscroll[0].scrollHeight 1471 } 1472 }; 1473 1474 this.onResize = function(e,page) { 1475 1476 if (!self.haswrapper&&!self.ispage) { 1477 if (self.win.css('display')=='none') { 1478 if (self.visibility) self.hideRail().hideRailHr(); 1479 return false; 1480 } else { 1481 if (!self.hidden&&!self.visibility) self.showRail().showRailHr(); 1482 } 1483 } 1484 1485 var premaxh = self.page.maxh; 1486 var premaxw = self.page.maxw; 1487 1488 var preview = {h:self.view.h,w:self.view.w}; 1489 1490 self.view = { 1491 w:(self.ispage) ? self.win.width() : parseInt(self.win[0].clientWidth), 1492 h:(self.ispage) ? self.win.height() : parseInt(self.win[0].clientHeight) 1493 }; 1494 1495 self.page = (page) ? page : self.getContentSize(); 1496 1497 self.page.maxh = Math.max(0,self.page.h - self.view.h); 1498 self.page.maxw = Math.max(0,self.page.w - self.view.w); 1499 1500 if ((self.page.maxh==premaxh)&&(self.page.maxw==premaxw)&&(self.view.w==preview.w)) { 1501 // test position 1502 if (!self.ispage) { 1503 var pos = self.win.offset(); 1504 if (self.lastposition) { 1505 var lst = self.lastposition; 1506 if ((lst.top==pos.top)&&(lst.left==pos.left)) return self; //nothing to do 1507 } 1508 self.lastposition = pos; 1509 } else { 1510 return self; //nothing to do 1511 } 1512 } 1513 1514 if (self.page.maxh==0) { 1515 self.hideRail(); 1516 self.scrollvaluemax = 0; 1517 self.scroll.y = 0; 1518 self.scrollratio.y = 0; 1519 self.cursorheight = 0; 1520 self.setScrollTop(0); 1521 self.rail.scrollable = false;
1522 } else { 1523 self.rail.scrollable = true; 1524 } 1525 1526 if (self.page.maxw==0) { 1527 self.hideRailHr(); 1528 self.scrollvaluemaxw = 0; 1529 self.scroll.x = 0; 1530 self.scrollratio.x = 0; 1531 self.cursorwidth = 0; 1532 self.setScrollLeft(0); 1533 self.railh.scrollable = false; 1534 } else { 1535 self.railh.scrollable = true; 1536 } 1537 1538 self.locked = (self.page.maxh==0)&&(self.page.maxw==0); 1539 if (self.locked) return false; 1540 1541 if (!self.hidden&&!self.visibility) { 1542 self.showRail().showRailHr(); 1543 } 1544 else if (!self.hidden&&!self.railh.visibility) self.showRailHr(); 1545 1546 if (self.istextarea&&self.win.css('resize')&&self.win.css('resize')!='none') self.view.h-=20; 1547 if (!self.ispage) self.updateScrollBar(self.view); 1548 1549 self.cursorheight = Math.min(self.view.h,Math.round(self.view.h * (self.view.h / self.page.h))); 1550 self.cursorheight = Math.max(self.opt.cursorminheight,self.cursorheight); 1551 1552 self.cursorwidth = Math.min(self.view.w,Math.round(self.view.w * (self.view.w / self.page.w))); 1553 self.cursorwidth = Math.max(self.opt.cursorminheight,self.cursorwidth); 1554 1555 self.scrollvaluemax = self.view.h-self.cursorheight-self.cursor.hborder; 1556 1557 if (self.railh) { 1558 self.railh.width = (self.page.maxh>0) ? (self.view.w-self.rail.width) : self.view.w; 1559 self.scrollvaluemaxw = self.railh.width-self.cursorwidth-self.cursorh.wborder; 1560 } 1561 1562 self.scrollratio = { 1563 x:(self.page.maxw/self.scrollvaluemaxw), 1564 y:(self.page.maxh/self.scrollvaluemax) 1565 }; 1566 1567 var sy = self.getScrollTop(); 1568 if (sy>self.page.maxh) { 1569 self.doScroll(self.page.maxh); 1570 } else { 1571 self.scroll.y = Math.round(self.getScrollTop() * (1/self.scrollratio.y)); 1572 self.scroll.x = Math.round(self.getScrollLeft() * (1/self.scrollratio.x)); 1573 if (self.cursoractive) self.noticeCursor(); 1574 } 1575 1576 if (self.scroll.y&&(self.getScrollTop()==0)) self.doScrollTo(Math.floor(self.scroll.y*self.scrollratio.y)); 1577 1578 return self; 1579 }; 1580 1581 this.resize = function(){self.delayed('resize',self.onResize,30);} // event debounce 1582 1583 this.lazyResize = function() { 1584 self.delayed('resize',self.resize,250); 1585 } 1586 1587 this._bind = function(el,name,fn,bubble) { // primitive bind 1588 self.events.push({e:el,n:name,f:fn}); 1589 if (el.addEventListener) { 1590 el.addEventListener(name,fn,bubble||false); 1591 } 1592 else if (el.attachEvent) { 1593 el.attachEvent("on"+name,fn); 1594 } 1595 else { 1596 el["on"+name] = fn; 1597 } 1598 }; 1599 1600 this.bind = function(dom,name,fn,bubble) { // touch-oriented & fixing jquery bind 1601 var el = ("jquery" in dom) ? dom[0] : dom; 1602 if (el.addEventListener) { 1603 if (cap.cantouch && /mouseup|mousedown|mousemove/.test(name)) { // touch device support 1604 var tt=(name=='mousedown')?'touchstart':(name=='mouseup')?'touchend':'touchmove'; 1605 self._bind(el,tt,function(e){ 1606 if (e.touches) { 1607 if (e.touches.length<2) {var ev=(e.touches.length)?e.touches[0]:e;ev.original=e;fn.call(this,ev);} 1608 } 1609 else if (e.changedTouches) {var ev=e.changedTouches[0];ev.original=e;fn.call(this,ev);} //blackberry 1610 },bubble||false); 1611 } 1612 self._bind(el,name,fn,bubble||false); 1613 if (name=='mousewheel') self._bind(el,"DOMMouseScroll",fn,bubble||false); 1614 if (cap.cantouch && name=="mouseup") self._bind(el,"touchcancel",fn,bubble||false); 1615 } 1616 else { 1617 self._bind(el,name,function(e) { 1618 e = e||window.event||false; 1619 if (e) { 1620 if (e.srcElement) e.target=e.srcElement; 1621 } 1622 return ((fn.call(el,e)===false)||bubble===false) ? self.cancelEvent(e) : true; 1623 }); 1624 } 1625 }; 1626 1627 this._unbind = function(el,name,fn) { // primitive unbind 1628 if (el.removeEventListener) { 1629 el.removeEventListener(name,fn,false); 1630 } 1631 else if (el.detachEvent) { 1632 el.detachEvent('on'+name,fn); 1633 } else { 1634 el['on'+name] = false;
1635 } 1636 }; 1637 1638 this.unbindAll = function() { 1639 for(var a=0;a<self.events.length;a++) { 1640 var r = self.events[a]; 1641 self._unbind(r.e,r.n,r.f); 1642 } 1643 }; 1644 1645 // Thanks to http://www.switchonthecode.com !! 1646 this.cancelEvent = function(e) { 1647 var e = (e.original) ? e.original : (e) ? e : window.event||false; 1648 if (!e) return false; 1649 if(e.preventDefault) e.preventDefault(); 1650 if(e.stopPropagation) e.stopPropagation(); 1651 if(e.preventManipulation) e.preventManipulation(); //IE10 1652 e.cancelBubble = true; 1653 e.cancel = true; 1654 e.returnValue = false; 1655 return false; 1656 }; 1657 1658 this.stopPropagation = function(e) { 1659 var e = (e.original) ? e.original : (e) ? e : window.event||false; 1660 if (!e) return false; 1661 if (e.stopPropagation) return e.stopPropagation(); 1662 if (e.cancelBubble) e.cancelBubble=true; 1663 return false; 1664 } 1665 1666 this.showRail = function() { 1667 if ((self.page.maxh!=0)&&(self.ispage||self.win.css('display')!='none')) { 1668 self.visibility = true; 1669 self.rail.visibility = true; 1670 self.rail.css('display','block'); 1671 } 1672 return self; 1673 }; 1674 1675 this.showRailHr = function() { 1676 if (!self.railh) return self; 1677 if ((self.page.maxw!=0)&&(self.ispage||self.win.css('display')!='none')) { 1678 self.railh.visibility = true; 1679 self.railh.css('display','block'); 1680 } 1681 return self; 1682 }; 1683 1684 this.hideRail = function() { 1685 self.visibility = false; 1686 self.rail.visibility = false; 1687 self.rail.css('display','none'); 1688 return self; 1689 }; 1690 1691 this.hideRailHr = function() { 1692 if (!self.railh) return self; 1693 self.railh.visibility = false; 1694 self.railh.css('display','none'); 1695 return self; 1696 }; 1697 1698 this.show = function() { 1699 self.hidden = false; 1700 self.locked = false; 1701 return self.showRail().showRailHr(); 1702 }; 1703 1704 this.hide = function() { 1705 self.hidden = true; 1706 self.locked = true; 1707 return self.hideRail().hideRailHr(); 1708 }; 1709 1710 this.remove = function() { 1711 self.doZoomOut(); 1712 self.unbindAll(); 1713 if (self.observer !== false) self.observer.disconnect(); 1714 self.events = []; 1715 if (self.cursor) { 1716 self.cursor.remove(); 1717 self.cursor = null; 1718 } 1719 if (self.cursorh) { 1720 self.cursorh.remove(); 1721 self.cursorh = null; 1722 } 1723 if (self.rail) { 1724 self.rail.remove(); 1725 self.rail = null; 1726 } 1727 if (self.railh) { 1728 self.railh.remove(); 1729 self.railh = null; 1730 } 1731 if (self.zoom) { 1732 self.zoom.remove(); 1733 self.zoom = null; 1734 } 1735 for(var a=0;a<self.saved.css.length;a++) { 1736 var d=self.saved.css[a]; 1737 d[0].css(d[1],(typeof d[2]=="undefined") ? '' : d[2]); 1738 } 1739 self.saved = false; 1740 self.me.data('__nicescroll',''); //erase all traces 1741 return self; 1742 }; 1743 1744 this.scrollstart = function(fn) { 1745 this.onscrollstart = fn; 1746 return self; 1747 } 1748 this.scrollend = function(fn) { 1749 this.onscrollend = fn; 1750 return self; 1751 } 1752 this.scrollcancel = function(fn) { 1753 this.onscrollcancel = fn; 1754 return self; 1755 } 1756 1757 this.zoomin = function(fn) { 1758 this.onzoomin = fn; 1759 return self; 1760 } 1761 this.zoomout = function(fn) { 1762 this.onzoomout = fn; 1763 return self; 1764 } 1765 1766 this.isScrollable = function(e) { 1767 var dom = (e.target) ? e.target : e; 1768 while (dom&&(dom.nodeType==1)&&!(/BODY|HTML/.test(dom.nodeName))) { 1769 var dd = $(dom); 1770 var ov = dd.css('overflowY')||dd.css('overflowX')||dd.css('overflow')||''; 1771 if (/scroll|auto/.test(ov)) return (dom.clientHeight!=dom.scrollHeight); 1772 dom = (dom.parentNode) ? dom.parentNode : false; 1773 } 1774 return false; 1775 }; 1776 1777 function execScrollWheel(e,hr) { 1778 var px = 0; 1779 var py = 0; 1780 if ("wheelDeltaY" in e) { 1781 px = e.wheelDeltaX; 1782 py = e.wheelDeltaY; 1783 } else { 1784 var delta = e.detail ? e.detail * -1 : e.wheelDelta / 40; 1785 if (delta) { 1786 (hr) ? px = Math.floor(delta*self.opt.mousescrollstep) : py = Math.floor(delta*self.opt.mousescrollstep); 1787 } 1788 } 1789 if (px) { 1790 if (self.scrollmom) {self.scrollmom.stop()} 1791 self.lastdeltax+=px; 1792 self.synched("mousewheelx",function(){var dt=self.lastdeltax;self.lastdeltax=0;if(!self.rail.drag){self.doScrollLeftBy(dt)}}); 1793 } 1794 if (py) { 1795 if (self.scrollmom) {self.scrollmom.stop()} 1796 self.lastdeltay+=py; 1797 self.synched("mousewheely",function(){var dt=self.lastdeltay;self.lastdeltay=0;if(!self.rail.drag){self.doScrollBy(dt)}}); 1798 } 1799 }; 1800 1801 this.onmousewheel = function(e) { 1802 if (self.locked) return true; 1803 if (!self.rail.scrollable) { 1804 if (self.railh&&self.railh.scrollable) { 1805 return self.onmousewheelhr(e); 1806 } else { 1807 return true; 1808 } 1809 } 1810 if (self.opt.preservenativescrolling&&self.checkarea) { 1811 self.checkarea = false;
1812 self.nativescrollingarea = self.isScrollable(e); 1813 } 1814 if (self.nativescrollingarea) return true; // this isn't my business 1815 if (self.locked) return self.cancelEvent(e); 1816 if (self.rail.drag) return self.cancelEvent(e); 1817 1818 execScrollWheel(e,false); 1819 1820 return self.cancelEvent(e); 1821 }; 1822 1823 this.onmousewheelhr = function(e) { 1824 if (self.locked||!self.railh.scrollable) return true; 1825 if (self.opt.preservenativescrolling&&self.checkarea) { 1826 self.checkarea = false; 1827 self.nativescrollingarea = self.isScrollable(e); 1828 } 1829 if (self.nativescrollingarea) return true; // this isn't my business 1830 if (self.locked) return self.cancelEvent(e); 1831 if (self.rail.drag) return self.cancelEvent(e); 1832 1833 execScrollWheel(e,true); 1834 1835 return self.cancelEvent(e); 1836 }; 1837 1838 this.stop = function() { 1839 self.cancelScroll(); 1840 if (self.scrollmon) self.scrollmon.stop(); 1841 self.cursorfreezed = false; 1842 self.scroll.y = Math.round(self.getScrollTop() * (1/self.scrollratio.y)); 1843 self.noticeCursor(); 1844 return self; 1845 }; 1846 1847 this.getTransitionSpeed = function(dif) { 1848 var sp = Math.round(self.opt.scrollspeed*10); 1849 var ex = Math.min(sp,Math.round((dif / 20) * self.opt.scrollspeed)); 1850 return (ex>
185020) ? ex : 0; 1851 } 1852 1853 if (!self.opt.smoothscroll) { 1854 this.doScrollLeft = function(x,spd) { //direct 1855 var y = self.getScrollTop(); 1856 self.doScrollPos(x,y,spd); 1857 } 1858 this.doScrollTop = function(y,spd) { //direct 1859 var x = self.getScrollLeft(); 1860 self.doScrollPos(x,y,spd); 1861 } 1862 this.doScrollPos = function(x,y,spd) { //direct 1863 var nx = (x>self.page.maxw) ? self.page.maxw : x; 1864 if (nx<0) nx=0; 1865 var ny = (y>self.page.maxh) ? self.page.maxh : y; 1866 if (ny<0) ny=0; 1867 self.synched('scroll',function(){ 1868 self.setScrollTop(ny); 1869 self.setScrollLeft(nx); 1870 }); 1871 } 1872 this.cancelScroll = function() {}; // direct 1873 } 1874 else if (self.ishwscroll&&cap.hastransition&&self.opt.usetransition) { 1875 this.prepareTransition = function(dif,istime) { 1876 var ex = (istime) ? ((dif>20)?dif:0) : self.getTransitionSpeed(dif); 1877 var trans = (ex) ? cap.prefixstyle+'transform '+ex+'ms ease-out' : ''; 1878 if (!self.lasttransitionstyle||self.lasttransitionstyle!=trans) { 1879 self.lasttransitionstyle = trans; 1880 self.doc.css(cap.transitionstyle,trans); 1881 } 1882 return ex; 1883 }; 1884 1885 this.doScrollLeft = function(x,spd) { //trans 1886 var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop(); 1887 self.doScrollPos(x,y,spd); 1888 } 1889 1890 this.doScrollTop = function(y,spd) { //trans 1891 var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft(); 1892 self.doScrollPos(x,y,spd); 1893 } 1894 1895 this.doScrollPos = function(x,y,spd) { //trans 1896 1897 var py = self.getScrollTop(); 1898 var px = self.getScrollLeft(); 1899 1900 if (((self.newscrolly-py)*(y-py)<0)||((self.newscrollx-px)*(x-px)<0)) self.cancelScroll(); //inverted movement detection 1901 1902 self.newscrolly = y; 1903 self.newscrollx = x; 1904 1905 self.newscrollspeed = spd||false; 1906 1907 if (self.timer) return false; 1908 1909 self.timer = setTimeout(function(){ 1910 1911 var top = self.getScrollTop(); 1912 var lft = self.getScrollLeft(); 1913 1914 var dst = {}; 1915 dst.x = x-lft; 1916 dst.y = y-top; 1917 dst.px = lft; 1918 dst.py = top; 1919 1920 var dd = Math.round(Math.sqrt(Math.pow(dst.x,2)+Math.pow(dst.y,2))); 1921 1922 var df = (self.newscrollspeed) ? self.newscrollspeed : dd; 1923 var ms = self.prepareTransition(df); 1924 1925 if (self.timerscroll&&self.timerscroll.tm) clearInterval(self.timerscroll.tm); 1926 1927 if (ms>0) { 1928 1929 if (!self.scrollrunning&&self.onscrollstart) { 1930 var info = {"type":"scrollstart","current":{"x":lft,"y":top},"request":{"x":x,"y":y},"end":{"x":self.newscrollx,"y":self.newscrolly},"speed":ms}; 1931 self.onscrollstart.call(self,info); 1932 } 1933 1934 if (cap.transitionend) { 1935 if (!self.scrollendtrapped) { 1936 self.scrollendtrapped = true; 1937 self.bind(self.doc,cap.transitionend,self.onScrollEnd,false); //I have got to do something usefull!! 1938 } 1939 } else { 1940 if (self.scrollendtrapped) clearTimeout(self.scrollendtrapped); 1941 self.scrollendtrapped = setTimeout(self.onScrollEnd,ms); // simulate transitionend event 1942 } 1943 1944 var py = top; 1945 var px = lft; 1946 self.timerscroll = { 1947 bz: new BezierClass(py,self.newscrolly,ms,0,0,0.58,1), 1948 bh: new BezierClass(px,self.newscrollx,ms,0,0,0.58,1) 1949 }; 1950 if (!self.cursorfreezed) self.timerscroll.tm=setInterval(function(){self.showCursor(self.getScrollTop(),self.getScrollLeft())},60); 1951 1952 } 1953 1954 self.synched("doScroll-set",function(){ 1955 self.timer = 0; 1956 if (self.scrollendtrapped) self.scrollrunning = true; 1957 self.setScrollTop(self.newscrolly); 1958 self.setScrollLeft(self.newscrollx); 1959 if (!self.scrollendtrapped) self.onScrollEnd(); 1960 }); 1961 1962 1963 },50); 1964 1965 }; 1966 1967 this.cancelScroll = function() { 1968 if (!self.scrollendtrapped) return true; 1969 var py = self.getScrollTop(); 1970 var px = self.getScrollLeft(); 1971 self.scrollrunning = false;
1972 if (!cap.transitionend) clearTimeout(cap.transitionend); 1973 self.scrollendtrapped = false; 1974 self._unbind(self.doc,cap.transitionend,self.onScrollEnd); 1975 self.prepareTransition(0); 1976 self.setScrollTop(py); // fire event onscroll 1977 if (self.railh) self.setScrollLeft(px); 1978 if (self.timerscroll&&self.timerscroll.tm) clearInterval(self.timerscroll.tm); 1979 self.timerscroll = false; 1980 1981 self.cursorfreezed = false; 1982 1983 self.noticeCursor(false,py,px); 1984 return self; 1985 }; 1986 this.onScrollEnd = function() { 1987 if (self.scrollendtrapped) self._unbind(self.doc,cap.transitionend,self.onScrollEnd); 1988 self.scrollendtrapped = false; 1989 self.prepareTransition(0); 1990 if (self.timerscroll&&self.timerscroll.tm) clearInterval(self.timerscroll.tm); 1991 self.timerscroll = false; 1992 var py = self.getScrollTop(); 1993 var px = self.getScrollLeft(); 1994 self.setScrollTop(py); // fire event onscroll 1995 if (self.railh) self.setScrollLeft(px); // fire event onscroll left 1996 1997 self.noticeCursor(false,py,px); 1998 1999 self.cursorfreezed = false; 2000 2001 if (py<0) py=0 2002 else if (py>self.page.maxh) py=self.page.maxh; 2003 if (px<0) px=0 2004 else if (px>self.page.maxw) px=self.page.maxw; 2005 if((py!=self.newscrolly)||(px!=self.newscrollx)) return self.doScrollPos(px,py,self.opt.snapbackspeed); 2006 2007 if (self.onscrollend&&self.scrollrunning) { 2008 var info = {"type":"scrollend","current":{"x":px,"y":py},"end":{"x":self.newscrollx,"y":self.newscrolly}}; 2009 self.onscrollend.call(self,info); 2010 } 2011 self.scrollrunning = false; 2012 2013 }; 2014 2015 } else { 2016 2017 this.doScrollLeft = function(x) { //no-trans 2018 var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop(); 2019 self.doScrollPos(x,y); 2020 } 2021 2022 this.doScrollTop = function(y) { //no-trans 2023 var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft(); 2024 self.doScrollPos(x,y); 2025 } 2026 2027 this.doScrollPos = function(x,y) { //no-trans 2028 var y = ((typeof y == "undefined")||(y===false)) ? self.getScrollTop(true) : y; 2029 2030 if ((self.timer)&&(self.newscrolly==y)&&(self.newscrollx==x)) return true; 2031 2032 if (self.timer) clearAnimationFrame(self.timer); 2033 self.timer = 0; 2034 2035 var py = self.getScrollTop(); 2036 var px = self.getScrollLeft(); 2037 2038 if (((self.newscrolly-py)*(y-py)<0)||((self.newscrollx-px)*(x-px)<0)) self.cancelScroll(); //inverted movement detection 2039 2040 self.newscrolly = y; 2041 self.newscrollx = x; 2042 2043 if (!self.bouncescroll||!self.rail.visibility) { 2044 if (self.newscrolly<0) { 2045 self.newscrolly = 0; 2046 } 2047 else if (self.newscrolly>self.page.maxh) { 2048 self.newscrolly = self.page.maxh; 2049 } 2050 } 2051 if (!self.bouncescroll||!self.railh.visibility) { 2052 if (self.newscrollx<0) { 2053 self.newscrollx = 0; 2054 } 2055 else if (self.newscrollx>self.page.maxw) { 2056 self.newscrollx = self.page.maxw; 2057 } 2058 } 2059 2060 self.dst = {}; 2061 self.dst.x = x-px; 2062 self.dst.y = y-py; 2063 self.dst.px = px; 2064 self.dst.py = py; 2065 2066 var dst = Math.round(Math.sqrt(Math.pow(self.dst.x,2)+Math.pow(self.dst.y,2))); 2067 2068 self.dst.ax = self.dst.x / dst; 2069 self.dst.ay = self.dst.y / dst; 2070 2071 var pa = 0; 2072 var pe = dst; 2073 2074 if (self.dst.x==0) { 2075 pa = py; 2076 pe = y; 2077 self.dst.ay = 1; 2078 self.dst.py = 0; 2079 } else if (self.dst.y==0) { 2080 pa = px; 2081 pe = x; 2082 self.dst.ax = 1; 2083 self.dst.px = 0; 2084 } 2085 2086 var ms = self.getTransitionSpeed(dst); 2087 if (ms>0) { 2088 self.bzscroll = (self.bzscroll) ? self.bzscroll.update(pe,ms) : new BezierClass(pa,pe,ms,0,1,0,1); 2089 } else { 2090 self.bzscroll = false;
2091 } 2092 2093 if (self.timer) return; 2094 2095 if ((py==self.page.maxh&&y>=self.page.maxh)||(px==self.page.maxw&&x>=self.page.maxw)) self.checkContentSize(); 2096 2097 var sync = 1; 2098 2099 function scrolling() { 2100 if (self.cancelAnimationFrame) return true; 2101 2102 self.scrollrunning = true; 2103 2104 sync = 1-sync; 2105 if (sync) return (self.timer = setAnimationFrame(scrolling)||1); 2106 2107 var done = 0; 2108 2109 var sc = sy = self.getScrollTop(); 2110 if (self.dst.ay) { 2111 sc = (self.bzscroll) ? self.dst.py + (self.bzscroll.getNow()*self.dst.ay) : self.newscrolly; 2112 var dr=sc-sy; 2113 if ((dr<0&&sc<self.newscrolly)||(dr>0&&sc>self.newscrolly)) sc = self.newscrolly; 2114 self.setScrollTop(sc); 2115 if (sc == self.newscrolly) done=1; 2116 } else { 2117 done=1; 2118 } 2119 2120 var scx = sx = self.getScrollLeft(); 2121 if (self.dst.ax) { 2122 scx = (self.bzscroll) ? self.dst.px + (self.bzscroll.getNow()*self.dst.ax) : self.newscrollx; 2123 var dr=scx-sx; 2124 if ((dr<0&&scx<self.newscrollx)||(dr>0&&scx>self.newscrollx)) scx = self.newscrollx; 2125 self.setScrollLeft(scx); 2126 if (scx == self.newscrollx) done+=1; 2127 } else { 2128 done+=1; 2129 } 2130 2131 if (done==2) { 2132 self.timer = 0; 2133 self.cursorfreezed = false; 2134 self.bzscroll = false; 2135 self.scrollrunning = false; 2136 if (sc<0) sc=0; 2137 else if (sc>self.page.maxh) sc=self.page.maxh; 2138 if (scx<0) scx=0; 2139 else if (scx>self.page.maxw) scx=self.page.maxw; 2140 if ((scx!=self.newscrollx)||(sc!=self.newscrolly)) self.doScrollPos(scx,sc); 2141 else { 2142 if (self.onscrollend) { 2143 var info = {"type":"scrollend","current":{"x":sx,"y":sy},"end":{"x":self.newscrollx,"y":self.newscrolly}}; 2144 self.onscrollend.call(self,info); 2145 } 2146 } 2147 } else { 2148 self.timer = setAnimationFrame(scrolling)||1; 2149 } 2150 }; 2151 self.cancelAnimationFrame=false; 2152 self.timer = 1; 2153 2154 if (self.onscrollstart&&!self.scrollrunning) { 2155 var info = {"type":"scrollstart","current":{"x":px,"y":py},"request":{"x":x,"y":y},"end":{"x":self.newscrollx,"y":self.newscrolly},"speed":ms}; 2156 self.onscrollstart.call(self,info); 2157 } 2158 2159 scrolling(); 2160 2161 if ((py==self.page.maxh&&y>=py)||(px==self.page.maxw&&x>=px)) self.checkContentSize(); 2162 2163 self.noticeCursor(); 2164 }; 2165 2166 this.cancelScroll = function() { 2167 if (self.timer) clearAnimationFrame(self.timer); 2168 self.timer = 0; 2169 self.bzscroll = false; 2170 self.scrollrunning = false; 2171 return self; 2172 }; 2173 2174 } 2175 2176 this.doScrollBy = function(stp,relative) { 2177 var ny = 0; 2178 if (relative) { 2179 ny = Math.floor((self.scroll.y-stp)*self.scrollratio.y) 2180 } else { 2181 var sy = (self.timer) ? self.newscrolly : self.getScrollTop(true); 2182 ny = sy-stp; 2183 } 2184 if (self.bouncescroll) { 2185 var haf = Math.round(self.view.h/2); 2186 if (ny<-haf) ny=-haf 2187 else if (ny>(self.page.maxh+haf)) ny = (self.page.maxh+haf); 2188 } 2189 self.cursorfreezed = false; 2190 2191 py = self.getScrollTop(true); 2192 if (ny<0&&py<=0) return self.noticeCursor(); 2193 else if (ny>self.page.maxh&&py>=self.page.maxh) { 2194 self.checkContentSize(); 2195 return self.noticeCursor(); 2196 } 2197 2198 self.doScrollTop(ny); 2199 }; 2200 2201 this.doScrollLeftBy = function(stp,relative) { 2202 var nx = 0; 2203 if (relative) { 2204 nx = Math.floor((self.scroll.x-stp)*self.scrollratio.x) 2205 } else { 2206 var sx = (self.timer) ? self.newscrollx : self.getScrollLeft(true); 2207 nx = sx-stp; 2208 } 2209 if (self.bouncescroll) { 2210 var haf = Math.round(self.view.w/2); 2211 if (nx<-haf) nx=-haf 2212 else if (nx>(self.page.maxw+haf)) nx = (self.page.maxw+haf); 2213 } 2214 self.cursorfreezed = false; 2215 2216 px = self.getScrollLeft(true); 2217 if (nx<0&&px<=0) return self.noticeCursor(); 2218 else if (nx>self.page.maxw&&px>=self.page.maxw) return self.noticeCursor(); 2219 2220 self.doScrollLeft(nx); 2221 }; 2222 2223 this.doScrollTo = function(pos,relative) { 2224 var ny = (relative) ? Math.round(pos*self.scrollratio.y) : pos; 2225 if (ny<0) ny=0 2226 else if (ny>self.page.maxh) ny = self.page.maxh; 2227 self.cursorfreezed = false;
2228 self.doScrollTop(pos); 2229 }; 2230 2231 this.checkContentSize = function() { 2232 var pg = self.getContentSize(); 2233 if ((pg.h!=self.page.h)||(pg.w!=self.page.w)) self.resize(false,pg); 2234 }; 2235 2236 self.onscroll = function(e) { 2237 if (self.rail.drag) return; 2238 if (!self.cursorfreezed) { 2239 self.synched('scroll',function(){ 2240 self.scroll.y = Math.round(self.getScrollTop() * (1/self.scrollratio.y)); 2241 if (self.railh) self.scroll.x = Math.round(self.getScrollLeft() * (1/self.scrollratio.x)); 2242 self.noticeCursor(); 2243 }); 2244 } 2245 }; 2246 self.bind(self.docscroll,"scroll",self.onscroll); 2247 2248 this.doZoomIn = function(e) { 2249 if (self.zoomactive) return; 2250 self.zoomactive = true; 2251 2252 self.zoomrestore = { 2253 style:{} 2254 }; 2255 var lst = ['position','top','left','zIndex','backgroundColor','marginTop','marginBottom','marginLeft','marginRight']; 2256 var win = self.win[0].style; 2257 for(var a in lst) { 2258 var pp = lst[a]; 2259 self.zoomrestore.style[pp] = (typeof win[pp]!='undefined') ? win[pp] : ''; 2260 } 2261 2262 self.zoomrestore.style.width = self.win.css('width'); 2263 self.zoomrestore.style.height = self.win.css('height'); 2264 2265 self.zoomrestore.padding = { 2266 w:self.win.outerWidth()-self.win.width(), 2267 h:self.win.outerHeight()-self.win.height() 2268 }; 2269 2270 if (cap.isios4) { 2271 self.zoomrestore.scrollTop = $(window).scrollTop(); 2272 $(window).scrollTop(0); 2273 } 2274 2275 self.win.css({ 2276 "position":(cap.isios4)?"absolute":"fixed", 2277 "top":0, 2278 "left":0, 2279 "z-index":self.opt.zindex+100, 2280 "margin":"0px" 2281 }); 2282 var bkg = self.win.css("backgroundColor"); 2283 if (bkg==""||/transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(bkg)) self.win.css("backgroundColor","#fff"); 2284 self.rail.css({"z-index":self.opt.zindex+110}); 2285 self.zoom.css({"z-index":self.opt.zindex+112}); 2286 self.zoom.css('backgroundPosition','0px -18px'); 2287 self.resizeZoom(); 2288 2289 if (self.onzoomin) self.onzoomin.call(self); 2290 2291 return self.cancelEvent(e); 2292 }; 2293 2294 this.doZoomOut = function(e) { 2295 if (!self.zoomactive) return; 2296 self.zoomactive = false; 2297 2298 self.win.css("margin",""); 2299 self.win.css(self.zoomrestore.style); 2300 2301 if (cap.isios4) { 2302 $(window).scrollTop(self.zoomrestore.scrollTop); 2303 } 2304 2305 self.rail.css({"z-index":(self.ispage)?self.opt.zindex:self.opt.zindex+2}); 2306 self.zoom.css({"z-index":self.opt.zindex}); 2307 self.zoomrestore = false; 2308 self.zoom.css('backgroundPosition','0px 0px'); 2309 self.onResize(); 2310 2311 if (self.onzoomout) self.onzoomout.call(self); 2312 2313 return self.cancelEvent(e); 2314 }; 2315 2316 this.doZoom = function(e) { 2317 return (self.zoomactive) ? self.doZoomOut(e) : self.doZoomIn(e); 2318 }; 2319 2320 this.resizeZoom = function() { 2321 if (!self.zoomactive) return; 2322 2323 var py = self.getScrollTop(); //preserve scrolling position 2324 self.win.css({ 2325 width:$(window).width()-self.zoomrestore.padding.w+"px", 2326 height:$(window).height()-self.zoomrestore.padding.h+"px" 2327 }); 2328 self.onResize(); 2329 self.setScrollTop(Math.min(self.page.maxh,py)); 2330 }; 2331 2332 this.init(); 2333 2334 $.nicescroll.push(this); 2335 2336 }; 2337 2338// Inspired by the work of Kin Blas 2339// http://webpro.host.adobe.com/people/jblas/momentum/includes/jquery.momentum.0.7.js 2340 2341 2342 var ScrollMomentumClass2D = function(nc) { 2343 var self = this; 2344 this.nc = nc; 2345 2346 this.lastx = 0; 2347 this.lasty = 0; 2348 this.speedx = 0; 2349 this.speedy = 0; 2350 this.lasttime = 0; 2351 this.steptime = 0; 2352 this.snapx = false; 2353 this.snapy = false; 2354 this.demulx = 0; 2355 this.demuly = 0; 2356 2357 this.lastscrollx = -1; 2358 this.lastscrolly = -1; 2359 2360 this.chkx = 0; 2361 this.chky = 0; 2362 2363 this.timer = 0; 2364 2365 this.time = function() { 2366 return +new Date();//beautifull hack 2367 }; 2368 2369 this.reset = function(px,py) { 2370 self.stop(); 2371 var now = self.time(); 2372 self.steptime = 0; 2373 self.lasttime = now; 2374 self.speedx = 0; 2375 self.speedy = 0; 2376 self.lastx = px; 2377 self.lasty = py; 2378 self.lastscrollx = -1; 2379 self.lastscrolly = -1; 2380 }; 2381 2382 this.update = function(px,py) { 2383 var now = self.time();
vendor: 5,980 bytes, lines 2384-2590
2384 self.steptime = now - self.lasttime; 2385 self.lasttime = now; 2386 var dy = py - self.lasty; 2387 var dx = px - self.lastx; 2388 var sy = self.nc.getScrollTop(); 2389 var sx = self.nc.getScrollLeft(); 2390 var newy = sy + dy; 2391 var newx = sx + dx; 2392 self.snapx = (newx<0)||(newx>self.nc.page.maxw); 2393 self.snapy = (newy<0)||(newy>self.nc.page.maxh); 2394 self.speedx = dx; 2395 self.speedy = dy; 2396 self.lastx = px; 2397 self.lasty = py; 2398 }; 2399 2400 this.stop = function() { 2401 self.nc.unsynched("domomentum2d"); 2402 if (self.timer) clearTimeout(self.timer); 2403 self.timer = 0; 2404 self.lastscrollx = -1; 2405 self.lastscrolly = -1; 2406 }; 2407 2408 this.doSnapy = function(nx,ny) { 2409 var snap = false; 2410 2411 if (ny<0) { 2412 ny=0; 2413 snap=true; 2414 } 2415 else if (ny>self.nc.page.maxh) { 2416 ny=self.nc.page.maxh; 2417 snap=true; 2418 } 2419 2420 if (nx<0) { 2421 nx=0; 2422 snap=true; 2423 } 2424 else if (nx>self.nc.page.maxw) { 2425 nx=self.nc.page.maxw; 2426 snap=true; 2427 } 2428 2429 if (snap) self.nc.doScrollPos(nx,ny,self.nc.opt.snapbackspeed); 2430 }; 2431 2432 this.doMomentum = function(gp) { 2433 var t = self.time(); 2434 var l = (gp) ? t+gp : self.lasttime; 2435 2436 var sl = self.nc.getScrollLeft(); 2437 var st = self.nc.getScrollTop(); 2438 2439 var pageh = self.nc.page.maxh; 2440 var pagew = self.nc.page.maxw; 2441 2442 self.speedx = (pagew>0) ? Math.min(60,self.speedx) : 0; 2443 self.speedy = (pageh>0) ? Math.min(60,self.speedy) : 0; 2444 2445 var chk = l && (t - l) <= 50; 2446 2447 if ((st<0)||(st>pageh)||(sl<0)||(sl>pagew)) chk = false; 2448 2449 var sy = (self.speedy && chk) ? self.speedy : false; 2450 var sx = (self.speedx && chk) ? self.speedx : false; 2451 2452 if (sy||sx) { 2453 var tm = Math.max(16,self.steptime); //timeout granularity 2454 2455 if (tm>50) { // do smooth 2456 var xm = tm/50; 2457 self.speedx*=xm; 2458 self.speedy*=xm; 2459 tm = 50; 2460 } 2461 2462 self.demulxy = 0; 2463 2464 self.lastscrollx = self.nc.getScrollLeft(); 2465 self.chkx = self.lastscrollx; 2466 self.lastscrolly = self.nc.getScrollTop(); 2467 self.chky = self.lastscrolly; 2468 2469 var nx = self.lastscrollx; 2470 var ny = self.lastscrolly; 2471 2472 var onscroll = function(){ 2473 var df = ((self.time()-t)>600) ? 0.04 : 0.02; 2474 2475 if (self.speedx) { 2476 nx = Math.floor(self.lastscrollx - (self.speedx*(1-self.demulxy))); 2477 self.lastscrollx = nx; 2478 if ((nx<0)||(nx>pagew)) df=0.10; 2479 } 2480 2481 if (self.speedy) { 2482 ny = Math.floor(self.lastscrolly - (self.speedy*(1-self.demulxy))); 2483 self.lastscrolly = ny; 2484 if ((ny<0)||(ny>pageh)) df=0.10; 2485 } 2486 2487 self.demulxy = Math.min(1,self.demulxy+df); 2488 2489 self.nc.synched("domomentum2d",function(){ 2490 2491 if (self.speedx) { 2492 var scx = self.nc.getScrollLeft(); 2493 if (scx!=self.chkx) self.stop(); 2494 self.chkx=nx; 2495 self.nc.setScrollLeft(nx); 2496 } 2497 2498 if (self.speedy) { 2499 var scy = self.nc.getScrollTop(); 2500 if (scy!=self.chky) self.stop(); 2501 self.chky=ny; 2502 self.nc.setScrollTop(ny); 2503 } 2504 2505 if(!self.timer) { 2506 self.nc.hideCursor(); 2507 self.doSnapy(nx,ny); 2508 } 2509 2510 }); 2511 2512 if (self.demulxy<1) { 2513 self.timer = setTimeout(onscroll,tm); 2514 } else { 2515 self.stop(); 2516 self.nc.hideCursor(); 2517 self.doSnapy(nx,ny); 2518 } 2519 }; 2520 2521 onscroll(); 2522 2523 } else { 2524 self.doSnapy(self.nc.getScrollLeft(),self.nc.getScrollTop()); 2525 } 2526 2527 } 2528 2529 }; 2530 2531 2532// override jQuery scrollTop 2533 2534 var _scrollTop = jQuery.fn.scrollTop; // preserve original function 2535 2536 $.cssHooks["scrollTop"] = { 2537 get: function(elem,computed,extra) { 2538 var nice = $.data(elem,'__nicescroll')||false; 2539 return (nice&&nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(elem); 2540 }, 2541 set: function(elem,value) { 2542 var nice = $.data(elem,'__nicescroll')||false; 2543 (nice&&nice.ishwscroll) ? nice.setScrollTop(parseInt(value)) : _scrollTop.call(elem,value); 2544 return this; 2545 } 2546 }; 2547 2548/* 2549 $.fx.step["scrollTop"] = function(fx){ 2550 $.cssHooks["scrollTop"].set( fx.elem, fx.now + fx.unit ); 2551 }; 2552*/ 2553 2554 jQuery.fn.scrollTop = function(value) { 2555 if (typeof value == "undefined") { 2556 var nice = (this[0]) ? $.data(this[0],'__nicescroll')||false : false; 2557 return (nice&&nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(this); 2558 } else { 2559 return this.each(function() { 2560 var nice = $.data(this,'__nicescroll')||false; 2561 (nice&&nice.ishwscroll) ? nice.setScrollTop(parseInt(value)) : _scrollTop.call($(this),value); 2562 }); 2563 } 2564 } 2565 2566// override jQuery scrollLeft 2567 2568 var _scrollLeft = jQuery.fn.scrollLeft; // preserve original function 2569 2570 $.cssHooks.scrollLeft = { 2571 get: function(elem,computed,extra) { 2572 var nice = $.data(elem,'__nicescroll')||false; 2573 return (nice&&nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(elem); 2574 }, 2575 set: function(elem,value) { 2576 var nice = $.data(elem,'__nicescroll')||false; 2577 (nice&&nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call(elem,value); 2578 return this; 2579 } 2580 }; 2581 2582/* 2583 $.fx.step["scrollLeft"] = function(fx){ 2584 $.cssHooks["scrollLeft"].set( fx.elem, fx.now + fx.unit ); 2585 }; 2586*/ 2587 2588 jQuery.fn.scrollLeft = function(value) { 2589 if (typeof value == "undefined") { 2590 var nice = (this[0]) ? $.data(this[0],'__nicescroll')||false : false;
2591 return (nice&&nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(this); 2592 } else { 2593 return this.each(function() { 2594 var nice = $.data(this,'__nicescroll')||false; 2595 (nice&&nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call($(this),value); 2596 }); 2597 } 2598 } 2599 2600 var NiceScrollArray = function(doms) { 2601 var self = this; 2602 this.length = 0; 2603 this.name = "nicescrollarray"; 2604 2605 this.each = function(fn) { 2606 for(var a=0;a<self.length;a++) fn.call(self[a]); 2607 return self; 2608 }; 2609 2610 this.push = function(nice) { 2611 self[self.length]=nice; 2612 self.length++; 2613 }; 2614 2615 this.eq = function(idx) { 2616 return self[idx]; 2617 }; 2618 2619 if (doms) { 2620 for(a=0;a<doms.length;a++) { 2621 var nice = $.data(doms[a],'__nicescroll')||false; 2622 if (nice) { 2623 this[this.length]=nice; 2624 this.length++; 2625 } 2626 }; 2627 } 2628 2629 return this; 2630 }; 2631 2632 function mplex(el,lst,fn) { 2633 for(var a=0;a<lst.length;a++) fn(el,lst[a]); 2634 }; 2635 mplex( 2636 NiceScrollArray.prototype, 2637 ['show','hide','onResize','resize','remove','stop','doScrollPos'], 2638 function(e,n) { 2639 e[n] = function(){ 2640 var args = arguments; 2641 return this.each(function(){ 2642 this[n].apply(this,args); 2643 }); 2644 }; 2645 } 2646 ); 2647 2648 jQuery.fn.getNiceScroll = function(index) { 2649 if (typeof index == "undefined") { 2650 return new NiceScrollArray(this); 2651 } else { 2652 var nice = $.data(this[index],'__nicescroll')||false; 2653 return nice; 2654 } 2655 }; 2656 2657 jQuery.extend(jQuery.expr[':'], { 2658 nicescroll: function(a) { 2659 return ($.data(a,'__nicescroll'))?true:false; 2660 } 2661 }); 2662 2663 $.fn.niceScroll = function(wrapper,opt) { 2664 if (typeof opt=="undefined") { 2665 if ((typeof wrapper=="object")&&!("jquery" in wrapper)) { 2666 opt = wrapper; 2667 wrapper = false; 2668 } 2669 } 2670 var ret = new NiceScrollArray(); 2671 if (typeof opt=="undefined") opt = {}; 2672 2673 if (wrapper||false) { 2674 opt.doc = $(wrapper); 2675 opt.win = $(this); 2676 } 2677 var docundef = !("doc" in opt); 2678 if (!docundef&&!("win" in opt)) opt.win = $(this); 2679 2680 this.each(function() { 2681 var nice = $(this).data('__nicescroll')||false; 2682 if (!nice) { 2683 opt.doc = (docundef) ? $(this) : opt.doc; 2684 nice = new NiceScrollClass(opt,$(this)); 2685 $(this).data('__nicescroll',nice); 2686 } 2687 ret.push(nice); 2688 }); 2689 return (ret.length==1) ? ret[0] : ret; 2690 }; 2691 2692 window.NiceScroll = { 2693 getjQuery:function(){return jQuery} 2694 }; 2695 2696 if (!$.nicescroll) { 2697 $.nicescroll = new NiceScrollArray(); 2698 } 2699 2700})( jQuery ); 2701
Line numbers count LF bytes from the start of the resource, as the search results do. Vendor segments are library code the classifier recognised; they are stored but not indexed. Bytes are shown as Latin1 characters, one per byte.